CAS 1402232-50-1: 1,3,4-Oxadiazole-2-carboxylic acid, 5-cyclopropyl-, ethyl ester

Description: 1,3,4-Oxadiazole-2-carboxylic acid, 5-cyclopropyl-, ethyl ester is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its potential reactivity and solubility properties. The presence of the cyclopropyl group introduces unique steric and electronic characteristics, which can influence the compound's biological activity and chemical behavior. Typically, oxadiazoles are known for their diverse applications in pharmaceuticals, agrochemicals, and materials science due to their ability to form hydrogen bonds and participate in various chemical reactions. The specific arrangement of substituents in this compound may also affect its stability, polarity, and interaction with biological targets. Overall, 1,3,4-Oxadiazole-2-carboxylic acid, 5-cyclopropyl-, ethyl ester represents a class of compounds with potential utility in medicinal chemistry and other fields.

Formula: C₈H₁₀N₂O₃

InChI: InChI=1S/C8H10N2O3/c1-2-12-8(11)7-10-9-6(13-7)5-3-4-5/h5H,2-4H2,1H3

InChI key: InChIKey=VTWNAIKWTWPTFX-UHFFFAOYSA-N

SMILES: O=C(OCC)C1=NN=C(O1)C2CC2

Synonyms:

• 1,3,4-Oxadiazole-2-carboxylic acid, 5-cyclopropyl-, ethyl ester
• Ethyl 5-cyclopropyl-1,3,4-oxadiazole-2-carboxylate

Ethyl 5-cyclopropyl-1,3,4-oxadiazole-2-carboxylate

CAS: 1402232-50-1

• Molecular weight: 182.1790008544922

Ethyl 5-cyclopropyl-1,3,4-oxadiazole-2-carboxylate

CAS: 1402232-50-1

Versatile small molecule scaffold

• Formula: C₈H₁₀N₂O₃
• Purity: Min. 95%
• Molecular weight: 182.18 g/mol