CAS 1402232-51-2

1-Oxa-4,9-diazaspiro[5.5]undecan-3-one, hydrochloride (1:1)

Description:

1-Oxa-4,9-diazaspiro[5.5]undecan-3-one, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. The presence of the spiro configuration indicates that the compound features two rings that share a single atom, contributing to its rigidity and potential biological activity. The hydrochloride form suggests that the compound is a salt, which can enhance its solubility in water and stability. This compound may exhibit properties typical of nitrogen-containing heterocycles, such as potential pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure likely influences its reactivity and interaction with biological targets. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions or cycloadditions. The specific applications and biological activities of this compound would depend on further research, including its synthesis, characterization, and evaluation in biological assays. Overall, 1-Oxa-4,9-diazaspiro[5.5]undecan-3-one, hydrochloride represents a class of compounds that could have significant implications in drug development and materials science.

Formula: C₈H₁₄N₂O₂·ClH

InChI: InChI=1S/C8H14N2O2.ClH/c11-7-5-12-8(6-10-7)1-3-9-4-2-8;/h9H,1-6H2,(H,10,11);1H

InChI key: InChIKey=VJMBTSAWEBOBJH-UHFFFAOYSA-N

SMILES: O=C1NCC2(OC1)CCNCC2.Cl

Synonyms:

• 1-Oxa-4,9-diazaspiro[5.5]undecan-3-one, hydrochloride (1:1)

1-Oxa-4,9-diazaspiro[5.5]undecan-3-one hydrochloride

CAS: 1402232-51-2

Formula: C₈H₁₅ClN₂O₂

Purity: 95%

Molecular weight: 206.67

Ref: 10-F214559