CAS 1402232-52-3
:2-(Cyclobutylmethoxy)-5-pyrimidinecarboxylic acid
Description:
2-(Cyclobutylmethoxy)-5-pyrimidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a carboxylic acid group and a cyclobutylmethoxy moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the pyrimidine and cyclobutyl groups. It is likely to be a solid at room temperature, with moderate solubility in polar solvents, reflecting the influence of the carboxylic acid functional group. The presence of the methoxy group can enhance its lipophilicity, potentially affecting its biological activity and interactions. As a pyrimidine derivative, it may exhibit properties relevant to medicinal chemistry, including potential applications in pharmaceuticals or agrochemicals. The compound's reactivity can be influenced by the functional groups present, making it a candidate for further chemical modifications or synthesis of derivatives. Overall, its unique structural features suggest a range of potential applications in various fields, including drug development and material science.
Formula:C10H12N2O3
InChI:InChI=1S/C10H12N2O3/c13-9(14)8-4-11-10(12-5-8)15-6-7-2-1-3-7/h4-5,7H,1-3,6H2,(H,13,14)
InChI key:InChIKey=PQKXXSYXRFVFNK-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C=2N=CC(C(O)=O)=CN2
Synonyms:- 5-Pyrimidinecarboxylic acid, 2-(cyclobutylmethoxy)-
- 2-(Cyclobutylmethoxy)-5-pyrimidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
