CymitQuimica logo

CAS 1402232-64-7

:

2-[(Tetrahydro-2H-pyran-4-yl)oxy]-5-pyrimidinecarboxylic acid

Description:
2-[(Tetrahydro-2H-pyran-4-yl)oxy]-5-pyrimidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a tetrahydro-2H-pyran moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylic acid functionalities, making it potentially useful in various chemical applications, including medicinal chemistry and organic synthesis. The presence of the tetrahydro-2H-pyran group may contribute to its solubility and stability, while the carboxylic acid group can participate in hydrogen bonding and other interactions, influencing its reactivity and biological activity. The compound's molecular structure suggests it may have potential as a bioactive agent, possibly interacting with biological targets due to its polar and non-polar regions. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in different solvents could provide insights into its potential applications in pharmaceuticals or agrochemicals. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C10H12N2O4
InChI:InChI=1S/C10H12N2O4/c13-9(14)7-5-11-10(12-6-7)16-8-1-3-15-4-2-8/h5-6,8H,1-4H2,(H,13,14)
InChI key:InChIKey=CKSNUUHETRUAOR-UHFFFAOYSA-N
SMILES:O(C=1N=CC(C(O)=O)=CN1)C2CCOCC2
Synonyms:
  • 2-[(Tetrahydro-2H-pyran-4-yl)oxy]-5-pyrimidinecarboxylic acid
  • 5-Pyrimidinecarboxylic acid, 2-[(tetrahydro-2H-pyran-4-yl)oxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.