CAS 1402232-85-2: 1-(3-Fluoro-2-pyridinyl)cyclopropanecarboxylic acid

Description: 1-(3-Fluoro-2-pyridinyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of a fluorine atom at the 3-position of the pyridine ring contributes to its electronic properties and potential reactivity. This compound typically exhibits acidic behavior due to the carboxylic acid functional group, which can donate protons in solution. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyridine ring is often found in biologically active compounds. The cyclopropane ring may impart strain, influencing the compound's reactivity and stability. Additionally, the fluorine substituent can enhance lipophilicity and metabolic stability, making it a valuable candidate for drug design. Overall, the characteristics of this compound, including its functional groups and structural features, suggest a versatile role in various chemical and biological applications.

Formula: C₉H₈FNO₂

InChI: InChI=1S/C9H8FNO2/c10-6-2-1-5-11-7(6)9(3-4-9)8(12)13/h1-2,5H,3-4H2,(H,12,13)

InChI key: InChIKey=MHAJPJCENLNPPX-UHFFFAOYSA-N

SMILES: O=C(O)C1(C2=NC=CC=C2F)CC1

Synonyms:

• Cyclopropanecarboxylic acid, 1-(3-fluoro-2-pyridinyl)-
• 1-(3-Fluoropyridin-2-yl)cyclopropane-1-carboxylic acid
• 1-(3-Fluoro-2-pyridinyl)cyclopropanecarboxylic acid

1-(3-Fluoropyridin-2-yl)cyclopropane-1-carboxylic acid

CAS: 1402232-85-2

• Molecular weight: 181.16600036621094

1-(3-Fluoropyridin-2-yl)cyclopropane-1-carboxylic acid

CAS: 1402232-85-2

Versatile small molecule scaffold

• Formula: C₉H₈FNO₂
• Purity: Min. 95%
• Molecular weight: 181.16 g/mol