CAS 1402232-97-6
:3-(Cyclobutylmethoxy)-2-pyridinecarboxylic acid
Description:
3-(Cyclobutylmethoxy)-2-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a carboxylic acid group and a cyclobutylmethoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the carboxylic acid functional group suggests acidic behavior, allowing it to participate in various chemical reactions, such as esterification or amidation. The cyclobutylmethoxy moiety may influence the compound's steric and electronic properties, potentially affecting its biological activity and interactions with other molecules. Additionally, the compound's molecular weight, melting point, and solubility in different solvents would be important for practical applications, including pharmaceuticals or agrochemicals. Overall, 3-(Cyclobutylmethoxy)-2-pyridinecarboxylic acid represents a versatile structure with potential utility in various chemical and biological contexts.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c13-11(14)10-9(5-2-6-12-10)15-7-8-3-1-4-8/h2,5-6,8H,1,3-4,7H2,(H,13,14)
InChI key:InChIKey=WIOXDRHDAVYXIQ-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C2=C(C(O)=O)N=CC=C2
Synonyms:- 2-Pyridinecarboxylic acid, 3-(cyclobutylmethoxy)-
- 3-(Cyclobutylmethoxy)-2-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
