CAS 1402233-01-5

1-(5-Fluoro-2-pyridinyl)cyclopropanemethanamine

Description:

1-(5-Fluoro-2-pyridinyl)cyclopropanemethanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of the 5-fluoro substituent on the pyridine ring enhances its biological activity and may influence its pharmacological properties. This compound is typically classified as an amine due to the presence of the amine functional group, which can participate in hydrogen bonding and affect its solubility and reactivity. The cyclopropane structure contributes to the compound's rigidity, potentially impacting its interaction with biological targets. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals targeting various diseases. The specific properties, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied.

Formula: C₉H₁₁FN₂

InChI: InChI=1S/C9H11FN2/c10-7-1-2-8(12-5-7)9(6-11)3-4-9/h1-2,5H,3-4,6,11H2

InChI key: InChIKey=HDTSFVPXCMCOQJ-UHFFFAOYSA-N

SMILES: C(N)C1(CC1)C2=CC=C(F)C=N2

Synonyms:

• 1-(5-Fluoro-2-pyridinyl)cyclopropanemethanamine
• Cyclopropanemethanamine, 1-(5-fluoro-2-pyridinyl)-

[1-(5-Fluoropyridin-2-yl)cyclopropyl]methanamine

CAS: 1402233-01-5

Versatile small molecule scaffold

Formula: C₉H₁₁FN₂

Purity: Min. 95%

Molecular weight: 166.2 g/mol

Ref: 3D-CGC23301