CAS 1402233-03-7
:Ethyl 5-cyclobutyl-1,3,4-oxadiazole-2-carboxylate
Description:
Ethyl 5-cyclobutyl-1,3,4-oxadiazole-2-carboxylate is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the cyclobutyl group enhances its structural diversity and may influence its biological activity. This compound typically exhibits moderate to high stability under standard conditions, although specific stability can depend on environmental factors such as temperature and pH. Its solubility properties may vary, often being soluble in organic solvents while having limited solubility in water. Ethyl 5-cyclobutyl-1,3,4-oxadiazole-2-carboxylate may also demonstrate interesting reactivity due to the presence of both ester and oxadiazole functionalities, making it a candidate for further chemical transformations. Additionally, its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery or development contexts. Overall, this compound represents a valuable entity for research and application in synthetic and medicinal chemistry.
Formula:C9H12N2O3
InChI:InChI=1S/C9H12N2O3/c1-2-13-9(12)8-11-10-7(14-8)6-4-3-5-6/h6H,2-5H2,1H3
InChI key:InChIKey=DKDKRLJTRVLMMS-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1OC(=NN1)C2CCC2
Synonyms:- 1,3,4-Oxadiazole-2-carboxylic acid, 5-cyclobutyl-, ethyl ester
- Ethyl 5-cyclobutyl-1,3,4-oxadiazole-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
