CAS 1402238-33-8

B-[5-Methyl-6-(1-methylethoxy)-3-pyridinyl]boronic acid

Description:

B-[5-Methyl-6-(1-methylethoxy)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a pyridine ring substituted with a methyl group and an ethoxy group, contributing to its unique chemical properties and reactivity. The presence of the boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, the steric and electronic properties imparted by the substituents on the pyridine ring can influence the compound's solubility, stability, and reactivity. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Overall, its structural characteristics position it as a valuable intermediate in the synthesis of complex organic molecules.

Formula: C₉H₁₄BNO₃

InChI: InChI=1S/C9H14BNO3/c1-6(2)14-9-7(3)4-8(5-11-9)10(12)13/h4-6,12-13H,1-3H3

InChI key: InChIKey=CDAZRJFZSURUSR-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=C(C)C=C(B(O)O)C=N1

Synonyms:

• B-[5-Methyl-6-(1-methylethoxy)-3-pyridinyl]boronic acid
• (6-Isopropoxy-5-methylpyridin-3-yl)boronic acid
• Boronic acid, B-[5-methyl-6-(1-methylethoxy)-3-pyridinyl]-
• [5-Methyl-6-(propan-2-yloxy)pyridin-3-yl]boronic acid

6-Isoproxy-5-methylpyridine-3-boronic acid

CAS: 1402238-33-8

Formula: C₉H₁₄BNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 195.0234

Ref: IN-DA009WV0

2-Isoproxy-3-methylpyridine-5-boronic acid

CAS: 1402238-33-8

2-Isoproxy-3-methylpyridine-5-boronic acid

Purity: 98%

Molecular weight: 195.02g/mol

Ref: 54-OR908450

(6-Isopropoxy-5-methylpyridin-3-yl)boronic acid

CAS: 1402238-33-8

Purity: 98%

Molecular weight: 195.0299988

Ref: 10-F691486