CAS 140226-30-8
:S-(3-oxopropyl)-N-acetylcysteine
Description:
S-(3-oxopropyl)-N-acetylcysteine, identified by its CAS number 140226-30-8, is a derivative of N-acetylcysteine (NAC), which is known for its antioxidant properties and role as a mucolytic agent. This compound features a propyl group with a ketone functional group, which contributes to its unique chemical reactivity and potential biological activity. The presence of the thiol group from cysteine allows for the formation of disulfide bonds, which can be significant in biochemical processes. S-(3-oxopropyl)-N-acetylcysteine may exhibit properties such as improved solubility and stability compared to its parent compound, potentially enhancing its therapeutic applications. It is often studied for its potential roles in cellular protection, detoxification, and as a precursor for the synthesis of glutathione, a critical antioxidant in the body. As with many sulfur-containing compounds, it may also participate in redox reactions, making it of interest in various fields, including pharmacology and biochemistry. Further research is necessary to fully elucidate its mechanisms of action and potential therapeutic benefits.
Formula:C8H13NO4S
InChI:InChI=1/C8H13NO4S/c1-6(11)9-7(8(12)13)5-14-4-2-3-10/h3,7H,2,4-5H2,1H3,(H,9,11)(H,12,13)
SMILES:CC(=NC(CSCCC=O)C(=O)O)O
Synonyms:- Sopa-cys
- N-acetyl-S-(3-oxopropyl)-L-cysteine
- N-acetyl-S-(3-oxopropyl)cysteine
- S-(3-Oxopropyl)-N-acetylcysteine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
N-Acetyl-S-(3-oxopropyl)-L-cysteine
CAS:Controlled ProductFormula:C8H13NO4SColor and Shape:NeatMolecular weight:219.258


