CAS 140235-34-3
:3-hydroxy-4-methoxy-4-oxobutanoic acid
Description:
3-Hydroxy-4-methoxy-4-oxobutanoic acid, identified by its CAS number 140235-34-3, is an organic compound characterized by the presence of a hydroxyl group (-OH), a methoxy group (-OCH3), and a ketone functional group within a butanoic acid framework. This compound typically exhibits properties associated with both acidic and alcohol functionalities, making it a versatile intermediate in organic synthesis. The presence of the methoxy group can influence its solubility and reactivity, often enhancing its lipophilicity compared to similar compounds. Additionally, the hydroxyl group contributes to its potential as a hydrogen bond donor, which can affect its interactions in biological systems or during chemical reactions. The compound may also display interesting biological activities, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Overall, 3-hydroxy-4-methoxy-4-oxobutanoic acid is a compound of interest due to its unique functional groups and potential utility in various chemical contexts.
Formula:C5H8O5
InChI:InChI=1S/C5H8O5/c1-10-5(9)3(6)2-4(7)8/h3,6H,2H2,1H3,(H,7,8)
InChI key:InChIKey=RTSODCRZYKSCLO-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(CC(O)=O)O
Synonyms:- Butanedioic acid, 2-hydroxy-, 1-methyl ester
- Malic acid 1-methyl ester
- 3-Hydroxy-4-methoxy-4-oxobutanoic acid
- 1-Methyl malate
- Butanedioic acid, hydroxy-, 1-methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Hydroxysuccinic Acid Methyl Ester (>90%)
CAS:Controlled ProductFormula:C5H8O5Color and Shape:NeatMolecular weight:148.112-Hydroxysuccinic acid methyl ester
CAS:<p>2-Hydroxysuccinic acid methyl ester is an organic compound that has a carbonyl group, a hydroxyl group, and two carboxylic esters. It is a colorless liquid with a sweet taste. 2-Hydroxysuccinic acid methyl ester is classified as a dicarboxylic acid. It can be found in nature as malic acid, which is found in apples and other fruits. 2-Hydroxysuccinic acid methyl ester can also be synthesized from citric acid and formaldehyde.</p>Formula:C5H8O5Purity:90% MinMolecular weight:148.11 g/mol


