CAS 14026-03-0
:R-N-NITROSO-2-METHYLPIPERIDINE
Description:
R-N-Nitroso-2-methylpiperidine is a chemical compound characterized by the presence of a nitroso group (–N=O) attached to a 2-methylpiperidine structure. This compound is part of a class of nitroso compounds, which are known for their potential biological activity and reactivity. The piperidine ring contributes to its cyclic structure, providing a six-membered nitrogen-containing heterocycle that can influence its chemical behavior and interactions. R-N-Nitroso-2-methylpiperidine may exhibit properties such as being a potential carcinogen, as many nitroso compounds are associated with mutagenic effects. Its solubility and stability can vary depending on the solvent and environmental conditions. Additionally, the compound's reactivity can lead to various chemical transformations, making it of interest in both synthetic chemistry and toxicology studies. Proper handling and safety precautions are essential when working with this compound due to its potential health risks.
Formula:C6H12N2O
InChI:InChI=1/C6H12N2O/c1-6-4-2-3-5-8(6)7-9/h6H,2-5H2,1H3/t6-/m1/s1
Synonyms:- Piperidine, 2-methyl-N-nitroso-, R(-)-
- R(-)-N-Nitroso-2-methyl-piperidin [German]
- (2R)-2-methyl-1-nitrosopiperidine
- R(-)-N-Nitroso-2-methyl-piperidin
- R(-)-N-Nitroso-alpha-pipecoline
- R(-)-N-Nitroso-2-methylpiperidine
- 2-methyl-1-nitrosopiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
