CAS 14026-45-0

6-Nitro-1,2,3,4-tetrahydroquinoline

Description:

6-Nitro-1,2,3,4-tetrahydroquinoline is a heterocyclic organic compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring and a nitro group at the 6-position. This compound typically appears as a yellow to orange solid and is soluble in organic solvents. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the nitro group can influence its reactivity and biological activity, making it a subject of interest in various chemical syntheses and studies. Additionally, the tetrahydroquinoline framework is known for its role in various natural products and synthetic compounds, often exhibiting interesting pharmacological properties. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 6-Nitro-1,2,3,4-tetrahydroquinoline represents a valuable compound in both research and industrial applications.

Formula: C₉H₁₀N₂O₂

InChI: InChI=1/C9H10N2O2/c12-11(13)8-3-4-9-7(6-8)2-1-5-10-9/h3-4,6,10H,1-2,5H2

SMILES: C1Cc2cc(ccc2NC1)N(=O)=O

Synonyms:

• Quinoline, 1,2,3,4-Tetrahydro-6-Nitro-

Quinoline, 1,2,3,4-tetrahydro-6-nitro-

CAS: 14026-45-0

Formula: C₉H₁₀N₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 178.1879

Ref: IN-DA001C8E

6-Nitro-1,2,3,4-tetrahydroquinoline

CAS: 14026-45-0

6-Nitro-1,2,3,4-tetrahydroquinoline

Purity: 99%

Molecular weight: 178.19g/mol

Ref: 54-OR951068

6-NITRO-1,2,3,4-TETRAHYDROQUINOLINE

CAS: 14026-45-0

Formula: C₉H₁₀N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 178.191

Ref: 10-F301800