CAS 1402612-64-9

4′-[1-[[2-(Phenylmethyl)-1-piperidinyl]carbonyl]-1H-1,2,3-triazol-4-yl][1,1′-biphenyl]-3-carboxylic acid

Description:

The chemical substance known as 4′-[1-[[2-(Phenylmethyl)-1-piperidinyl]carbonyl]-1H-1,2,3-triazol-4-yl][1,1′-biphenyl]-3-carboxylic acid, with the CAS number 1402612-64-9, is a complex organic compound characterized by its multi-functional structure. It features a biphenyl core, which is substituted with a carboxylic acid group and a triazole moiety, linked to a piperidine derivative that contains a phenylmethyl group. This structural arrangement suggests potential biological activity, possibly as a pharmaceutical agent, due to the presence of the piperidine and triazole functionalities, which are often associated with various therapeutic effects. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular architecture. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopy and chromatography, to confirm its identity and purity. Overall, this compound represents a class of molecules that may have applications in medicinal chemistry and drug development.

Formula: C₂₈H₂₆N₄O₃

InChI: InChI=1S/C28H26N4O3/c33-27(34)24-10-6-9-23(18-24)21-12-14-22(15-13-21)26-19-32(30-29-26)28(35)31-16-5-4-11-25(31)17-20-7-2-1-3-8-20/h1-3,6-10,12-15,18-19,25H,4-5,11,16-17H2,(H,33,34)

InChI key: InChIKey=SSSCOJOXPDDHOO-UHFFFAOYSA-N

SMILES: C(=O)(N1C(CC2=CC=CC=C2)CCCC1)N3C=C(N=N3)C4=CC=C(C=C4)C5=CC(C(O)=O)=CC=C5

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 4′-[1-[[2-(phenylmethyl)-1-piperidinyl]carbonyl]-1H-1,2,3-triazol-4-yl]-
• KT 203
• 4′-[1-[[2-(Phenylmethyl)-1-piperidinyl]carbonyl]-1H-1,2,3-triazol-4-yl][1,1′-biphenyl]-3-carboxylic acid

KT203

CAS: 1402612-64-9

KT203

Purity: ≥98%

Molecular weight: 466.53g/mol

Ref: 54-BUP14329

KT203

Controlled Product

CAS: 1402612-64-9

KT203 is a cannabinoid-receptor binding inhibitor that has been shown to inhibit the 2-arachidonoylglycerol (2-AG) receptor. KT203 is a potent and specific inhibitor of the CB1 receptor, with little affinity for other receptors or ion channels. KT203 has been shown to inhibit the entry of human immunodeficiency virus (HIV) into cells by preventing the interaction of HIV with its target cell surface glycoprotein, gp120. KT203 has also been used to study demyelination and polymerase chain reaction (PCR). In vitro studies have shown that KT203 can inhibit these diseases in neurons in culture. The drug was repurposed from its original use as an antihistamine and is now being studied as a potential treatment for multiple sclerosis.

Formula: C₂₈H₂₆N₄O₃

Purity: Min. 95%

Molecular weight: 466.53 g/mol

Ref: 3D-CGC61264

KT203

CAS: 1402612-64-9

KT203 is an α/β hydrolase structural domain 6 (ABHD6) inhibitor with potential antiviral and anti-inflammatory activity for the study of pneumonia.

Formula: C₂₈H₂₆N₄O₃

Purity: 98.51%

Color and Shape: Solid

Molecular weight: 466.53

Ref: TM-T11785