CAS 14027-75-9

3-Fluoro-5-nitrobenzoic acid

Description:

3-Fluoro-5-nitrobenzoic acid is an aromatic carboxylic acid characterized by the presence of both a fluoro and a nitro group on the benzene ring. Specifically, the fluoro group is located at the meta position (3-position) relative to the carboxylic acid group, while the nitro group is situated at the para position (5-position). This compound typically appears as a crystalline solid and is known for its moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The nitro group contributes to the compound's electron-withdrawing properties, influencing its reactivity and acidity. 3-Fluoro-5-nitrobenzoic acid is utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals. Its unique functional groups make it a valuable intermediate in organic synthesis, allowing for further derivatization and modification. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₇H₄FNO₄

InChI: InChI=1/C7H4FNO4/c8-5-1-4(7(10)11)2-6(3-5)9(12)13/h1-3H,(H,10,11)

SMILES: c1c(cc(cc1F)N(=O)=O)C(=O)O

Synonyms:

• Benzoic acid, 3-fluoro-5-nitro-
• 3-FLUORO-5-NITROBENZOIC ACID

Benzoic acid, 3-fluoro-5-nitro-

CAS: 14027-75-9

Formula: C₇H₄FNO₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 185.1094

Ref: IN-DA001C89

3-Fluoro-5-nitrobenzoic acid

CAS: 14027-75-9

3-Fluoro-5-nitrobenzoic acid

Formula: C₇H₄FNO₄

Purity: 98%

Color and Shape: white solid

Molecular weight: 185.11g/mol

Ref: 54-PC48725

3-Fluoro-5-nitrobenzoic acid

CAS: 14027-75-9

Formula: C₇H₄FNO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 185.11

Ref: 10-F022027