CAS 1403-56-1
:fomecin A
Description:
Fomecin A, with the CAS number 1403-56-1, is a naturally occurring compound classified as a polyketide antibiotic. It is primarily produced by certain strains of the bacterium *Streptomyces*. Fomecin A exhibits notable antibacterial properties, making it of interest in the field of medicinal chemistry and pharmacology. The compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. It is typically soluble in organic solvents and has a relatively low solubility in water, which is common for many polyketides. Fomecin A has been studied for its potential applications in treating bacterial infections, particularly those caused by resistant strains. Its mechanism of action often involves inhibition of bacterial protein synthesis, although specific pathways may vary. Research continues to explore its efficacy, safety, and potential modifications to enhance its therapeutic profile. As with many antibiotics, the development of resistance is a concern, prompting ongoing studies into its use and effectiveness in clinical settings.
Formula:C8H8O5
InChI:InChI=1/C8H8O5/c9-2-4-1-6(11)8(13)7(12)5(4)3-10/h1,3,9,11-13H,2H2
Synonyms:- Fomecin
- NSC 73231
- Fomecin-A
- 2,3,4-Trihydroxy-6-(hydroxymethyl)benzaldehyde
- Benzaldehyde, 2,3,4-trihydroxy-6-(hydroxymethyl)- (9CI)
- BRN 2693556
- 4-08-00-03351 (Beilstein Handbook Reference)
- Fomecin A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
