CymitQuimica logo

CAS 1403474-75-8

:

Ethyl 2-ethoxy-1-[[2′-[[[(ethoxycarbonyl)oxy]amino]iminomethyl][1,1′-biphenyl]-4-yl]methyl]-1H-benzimidazole-7-carboxylate

Description:
Ethyl 2-ethoxy-1-[[2′-[[[(ethoxycarbonyl)oxy]amino]iminomethyl][1,1′-biphenyl]-4-yl]methyl]-1H-benzimidazole-7-carboxylate, identified by its CAS number 1403474-75-8, is a complex organic compound characterized by its multi-functional structure. It features a benzimidazole core, which is known for its biological activity, particularly in pharmaceuticals. The presence of ethoxy and ethoxycarbonyl groups suggests it may exhibit solubility in organic solvents and potential reactivity in various chemical environments. The compound's structure includes multiple aromatic rings, which can contribute to its stability and electronic properties. Additionally, the presence of amino and carboxylate functionalities indicates potential for hydrogen bonding and interactions with biological targets. Such characteristics may render this compound of interest in medicinal chemistry, particularly for developing new therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C29H30N4O6
InChI:InChI=1S/C29H30N4O6/c1-4-36-27(34)23-12-9-13-24-25(23)33(28(31-24)37-5-2)18-19-14-16-20(17-15-19)21-10-7-8-11-22(21)26(30)32-39-29(35)38-6-3/h7-17H,4-6,18H2,1-3H3,(H2,30,32)
InChI key:InChIKey=GHUWIXWDEUORAE-UHFFFAOYSA-N
SMILES:C(N1C=2C(N=C1OCC)=CC=CC2C(OCC)=O)C3=CC=C(C=C3)C4=C(C(NOC(OCC)=O)=N)C=CC=C4
Synonyms:
  • 2-Ethoxy-1-[[2′-[[(ethoxycarbonyloxy)amino](imino)methyl]biphenyl-4-yl]methyl]-1H-benzimidazole-7-carboxylic acid ethyl ester
  • Ethyl 2-ethoxy-1-[[2′-[[[(ethoxycarbonyl)oxy]amino]iminomethyl][1,1′-biphenyl]-4-yl]methyl]-1H-benzimidazole-7-carboxylate
  • 1H-Benzimidazole-7-carboxylic acid, 2-ethoxy-1-[[2′-[[[(ethoxycarbonyl)oxy]amino]iminomethyl][1,1′-biphenyl]-4-yl]methyl]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.