CAS 14036-96-5

3-bromo-6-methoxyquinoline

Description:

3-Bromo-6-methoxyquinoline is an organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a bromine atom at the 3-position and a methoxy group at the 6-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit antimicrobial, anti-inflammatory, or anticancer properties, making it of interest in drug discovery. The methoxy group enhances its solubility and reactivity, while the bromine atom can serve as a site for further chemical modifications. In terms of stability, 3-bromo-6-methoxyquinoline is generally stable under standard conditions but may be sensitive to strong acids or bases. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₀H₈BrNO

InChI: InChI=1/C10H8BrNO/c1-13-9-2-3-10-7(5-9)4-8(11)6-12-10/h2-6H,1H3

SMILES: COc1ccc2c(cc(cn2)Br)c1

Synonyms:

• Quinoline, 3-Bromo-6-Methoxy-
• 3-Bromo-6-methoxyquinoline

3-Bromo-6-methoxyquinoline

CAS: 14036-96-5

Formula: C₁₀H₈BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 238.0806

Ref: IN-DA009CQK

3-Bromo-6-methoxyquinoline

CAS: 14036-96-5

3-Bromo-6-methoxyquinoline

Formula: C₁₀H₈BrNO

Purity: 99%

Color and Shape: pale yellow solid

Molecular weight: 238.08g/mol

Ref: 54-OR315550

3-BROMO-6-METHOXYQUINOLINE

CAS: 14036-96-5

Formula: C₁₀H₈BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 238.084

Ref: 10-F305861

3-Bromo-6-methoxyquinoline

CAS: 14036-96-5

Versatile small molecule scaffold

Formula: C₁₀H₈BrNO

Purity: Min. 95%

Molecular weight: 238.08 g/mol

Ref: 3D-PAA03696