CymitQuimica logo

CAS 140373-17-7

:

beta-amino-4-fluoro-Benzeneethanol

Description:
Beta-amino-4-fluoro-benzeneethanol, identified by its CAS number 140373-17-7, is an organic compound characterized by the presence of both an amino group and a hydroxyl group attached to a benzene ring that also features a fluorine substituent. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group, while the fluorine atom can influence its reactivity and polarity. The amino group can participate in hydrogen bonding, enhancing its interaction with other molecules. Additionally, the presence of the fluorine atom may impart unique electronic properties, affecting the compound's overall stability and reactivity. Beta-amino-4-fluoro-benzeneethanol may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex chemical structures. As with many organic compounds, safety and handling precautions should be observed, given the potential hazards associated with its chemical properties.
Formula:C8H10FNO
InChI:InChI=1S/C8H10FNO/c9-7-3-1-6(2-4-7)8(10)5-11/h1-4,8,11H,5,10H2
InChI key:SRQPEYLZIUEVIA-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(CO)N)F
Synonyms:
  • Benzeneethanol, beta-amino-4-fluoro-
Found 4 products.