CymitQuimica logo

CAS 1403746-38-2

:

Bicyclo[1.1.1]pentan-1-ylhydrazinedihydrochloride

Description:
Bicyclo[1.1.1]pentan-1-ylhydrazinedihydrochloride is a chemical compound characterized by its bicyclic structure, which consists of a bicyclo[1.1.1]pentane framework attached to a hydrazine moiety. This compound features two hydrochloride groups, indicating that it is a salt formed with hydrochloric acid. The bicyclic structure contributes to its unique steric and electronic properties, which can influence its reactivity and interactions with other molecules. Typically, compounds like this may exhibit interesting biological activities or serve as intermediates in synthetic chemistry. The presence of hydrazine suggests potential applications in the synthesis of various nitrogen-containing compounds, as hydrazines are known for their reactivity in forming hydrazones and other derivatives. Additionally, the dihydrochloride form enhances its solubility in polar solvents, making it more accessible for various chemical reactions. As with many hydrazine derivatives, safety precautions should be taken due to potential toxicity and reactivity. Overall, Bicyclo[1.1.1]pentan-1-ylhydrazinedihydrochloride is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C5H12Cl2N2
InChI:InChI=1S/C5H10N2.2ClH/c6-7-5-1-4(2-5)3-5;;/h4,7H,1-3,6H2;2*1H
InChI key:ACIFIPVVZLEAQV-UHFFFAOYSA-N
SMILES:C1C2CC1(C2)NN.Cl.Cl
Found 5 products.