CAS 1403764-72-6
:2-Methoxy-N-(3-methyl-2-oxo-1,2,3,4-tetrahydroquinazolin-6-yl)benzenesulfonamide
Description:
2-Methoxy-N-(3-methyl-2-oxo-1,2,3,4-tetrahydroquinazolin-6-yl)benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a methoxy group, a sulfonamide moiety, and a tetrahydroquinazoline ring. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity would depend on its interaction with biological targets. The presence of the methoxy group may influence its solubility and lipophilicity, while the tetrahydroquinazoline structure could contribute to its pharmacological profile. The compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its synthesis would involve multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C16H17N3O4S
InChI:InChI=1S/C16H17N3O4S/c1-19-10-11-9-12(7-8-13(11)17-16(19)20)18-24(21,22)15-6-4-3-5-14(15)23-2/h3-9,18H,10H2,1-2H3,(H,17,20)
InChI key:InChIKey=TXZPMHLMPKIUGK-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=C(OC)C=CC=C1)C=2C=C3C(=CC2)NC(=O)N(C)C3
Synonyms:- PF 6405761
- 2-Methoxy-N-(3-methyl-2-oxo-1,2,3,4-tetrahydroquinazolin-6-yl)benzenesulfonamide
- PFI 1
- Benzenesulfonamide, 2-methoxy-N-(1,2,3,4-tetrahydro-3-methyl-2-oxo-6-quinazolinyl)-
- 2-Methoxy-N-(1,2,3,4-tetrahydro-3-methyl-2-oxo-6-quinazolinyl)benzenesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Methoxy-N-(3-Methyl-2-Oxo-1,2,3,4-Tetrahydroquinazolin-6-yl)Benzenesulfonamide
CAS:2-Methoxy-N-(3-Methyl-2-Oxo-1,2,3,4-Tetrahydroquinazolin-6-yl)BenzenesulfonamidePurity:98%Molecular weight:347.39g/molPFI-1
CAS:PFI-1 (PF-6405761), a specific BET (bromodomain-containing protein) inhibitor for BRD4, is with the IC50 of 0.22 μM in a cell-free assay.Formula:C16H17N3O4SPurity:98.74% - 99.19%Color and Shape:SolidMolecular weight:347.39Ref: 10-F811897
1gTo inquire1mgTo inquire5mgTo inquire10mgTo inquire50mgTo inquire100mgTo inquire250mgTo inquirePFI-1 (PF-6405761)
CAS:PFI-1 is a protein inhibitor that inhibits transcriptional regulation through the inhibition of histone acetylation. PFI-1 has been shown to inhibit the replication of HIV and influenza A virus in vitro. PFI-1 binds to the acetylated lysine residues on histones, preventing their acetylation by HDACs and inhibiting transcriptional regulation. The mechanism of action for PFI-1 is not well understood, but it has been shown to inhibit proliferation of prostate cancer cells and may be a potential therapeutic agent for treatment of autoimmune diseases.Formula:C16H17N3O4SPurity:Min. 95%Molecular weight:347.39 g/mol




