CAS 1403766-73-3

[1,3′-Biazetidin]-3-ol, 3-methyl-, hydrochloride (1:2)

Description:

[1,3′-Biazetidin]-3-ol, 3-methyl-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which includes two azetidine rings. This compound features a hydroxyl group (-OH) and a methyl group (-CH3) attached to the azetidine framework, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances solubility in water and stability. The presence of the hydroxyl group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug design or synthesis. However, specific applications, biological activities, and safety profiles would require further investigation through empirical studies and literature review. As with any chemical substance, proper handling and safety precautions should be observed, particularly in laboratory settings.

Formula: C₇H₁₄N₂O·2ClH

InChI: InChI=1S/C7H14N2O.2ClH/c1-7(10)4-9(5-7)6-2-8-3-6;;/h6,8,10H,2-5H2,1H3;2*1H

InChI key: InChIKey=HNODAGHGSPSEMI-UHFFFAOYSA-N

SMILES: CC1(O)CN(C1)C2CNC2.Cl

Synonyms:

• [1,3′-Biazetidin]-3-ol, 3-methyl-, hydrochloride (1:2)

3-Methyl-[1,3'-biazetidin]-3-ol dihydrochloride

CAS: 1403766-73-3

Formula: C₇H₁₆Cl₂N₂O

Purity: 95%

Molecular weight: 215.1207

Ref: IN-DA009XKI

1-(Azetidin-3-yl)-3-methylazetidin-3-ol dihydrochloride

CAS: 1403766-73-3

1-(Azetidin-3-yl)-3-methylazetidin-3-ol dihydrochloride

Purity: ≥95%

Molecular weight: 215.12g/mol

Ref: 54-OR302680

3-Methyl-[1,3'-biazetidin]-3-ol dihydrochloride

CAS: 1403766-73-3

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 215.1199951171875

Ref: 10-F462290