CAS 1403767-21-4: Piperidine, 4-(3-fluoro-1-azetidinyl)-, hydrochloride (1:2)
Description:Piperidine, 4-(3-fluoro-1-azetidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a 3-fluoro-1-azetidinyl substituent indicates that the compound has a fluorine atom attached to a four-membered azetidine ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its structure suggests that it could interact with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further characterization through methods such as NMR, IR spectroscopy, and mass spectrometry would provide additional insights into its properties and behavior.
Formula:C8H15FN2·2ClH
InChI:InChI=1S/C8H15FN2.2ClH/c9-7-5-11(6-7)8-1-3-10-4-2-8;;/h7-8,10H,1-6H2;2*1H
InChI key:InChIKey=KWJIIDADNONRBR-UHFFFAOYSA-N
SMILES:Cl.FC1CN(C1)C2CCNCC2
- Synonyms:
- Piperidine, 4-(3-fluoro-1-azetidinyl)-, hydrochloride (1:2)
Piperidine, 4-(3-fluoro-1-azetidinyl)-, hydrochloride (1:2)
Ref: IN-DA001CAH
| Undefined size | To inquire |
4-(3-Fluoroazetidin-1-yl)piperidine dihydrochloride
Ref: 54-PC400508
| 250mg | 755.00 € |
4-(3-Fluoroazetidin-1-yl)piperidine dihydrochloride
Ref: 10-F462304
| 1g | To inquire | ||
| 250mg | To inquire |
4-(3-Fluoroazetidin-1-yl)piperidine dihydrochloride
Ref: 3D-DGC76721
| 5mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
