CAS 1404-55-3
:Ristocetin
Description:
Ristocetin is a glycopeptide antibiotic that is primarily derived from the fermentation of the bacterium Nocardia lurida. It is known for its ability to inhibit bacterial cell wall synthesis, making it effective against certain Gram-positive bacteria. Ristocetin exhibits a unique mechanism of action by binding to the D-alanyl-D-alanine terminus of peptidoglycan precursors, which interferes with the transpeptidation process essential for cell wall integrity. In addition to its antibacterial properties, ristocetin is notable for its role in laboratory settings, particularly in the ristocetin cofactor assay, which is used to evaluate von Willebrand factor activity in blood coagulation studies. The substance is characterized by its complex structure, which includes multiple sugar moieties and amino acid residues, contributing to its biological activity. While it has therapeutic applications, its use has diminished due to the emergence of resistant bacterial strains and the availability of more effective antibiotics. Safety and handling precautions are necessary, as with many antibiotics, due to potential side effects and toxicity.
Formula:Unspecified
InChI:InChI=1/C98H113N7O43/c1-30-50(111)20-39-22-54(30)138-55-21-33(5-12-49(55)110)63(100)88(127)105-67-70(115)35-7-13-52-37(15-35)18-44-62-45-19-38-16-36(8-14-53(38)140-84(45)87(83(44)139-52)148-98-86(78(123)74(119)59(144-98)29-135-94-80(125)75(120)69(114)32(3)137-94)147-97-85(77(122)73(118)58(27-107)143-97)146-95-79(124)71(116)51(112)28-134-95)82(145-60-25-46(99)68(113)31(2)136-60)47-10-9-41(93(132)133-4)42-23-40(108)24-56(141-96-81(126)76(121)72(117)57(26-106)142-96)61(42)43-17-34(6-11-48(43)109)64(89(128)101-47)102-91(130)66(62)104-90(129)65(39)103-92(67)131/h5-8,11-17,20-24,31-32,41,46-47,51,57-60,63-82,85-86,94-98,106-126H,9-10,18-19,25-29,99-100H2,1-4H3,(H,101,128)(H,102,130)(H,103,131)(H,104,129)(H,105,127)/t31-,32+,41-,46+,47+,51-,57+,58-,59-,60+,63+,64+,65-,66+,67+,68-,69+,70+,71-,72+,73-,74-,75-,76-,77+,78+,79+,80-,81-,82+,85+,86-,94-,95+,96+,97-,98+/m0/s1
Synonyms:- Antibiotic obtained from cultures of Nocardia lurida, or the same substance produced by any other means
- Ristocetin [INN:BAN]
- Ristocetina
- Ristocetina [INN-Spanish]
- Ristocetins
- Ristomycin
- Ristomycins
- Riston
- Spontin
- Ristocetin
- Ristocetin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Ristocetin
CAS:Ristocetin, an antibiotic from Amycolatopsis lurida, treated staph infections but was discontinued due to causing thrombocytopenia.Formula:C95H110N8O44Purity:98%Color and Shape:SolidMolecular weight:2067.937
