CAS 14040-20-1
:BENZYL 2-ACETAMIDO-3-O-BENZYL-4,6-O-BENZYLIDENE-2-DEOXY-BETA-D-GLUCOPYRANOSIDE
Description:
Benzyl 2-acetamido-3-O-benzyl-4,6-O-benzylidene-2-deoxy-beta-D-glucopyranoside is a complex glycoside derivative characterized by its structural components, which include a glucopyranoside backbone modified with multiple benzyl and acetamido groups. This compound typically exhibits solubility in organic solvents due to its hydrophobic benzyl groups, while its glucopyranoside structure contributes to its potential interactions in biological systems. The presence of the acetamido group suggests that it may participate in hydrogen bonding, influencing its reactivity and stability. Additionally, the benzylidene acetal formation provides protection for the hydroxyl groups, which can be crucial in synthetic applications. This compound may be of interest in medicinal chemistry and carbohydrate chemistry, particularly for its potential use in drug design or as a biochemical probe. Its synthesis and characterization would involve standard organic chemistry techniques, including protection-deprotection strategies and possibly glycosylation reactions. Overall, its unique structure may confer specific biological activities or properties that warrant further investigation.
Formula:C29H31NO6
InChI:InChI=1/C29H31NO6/c1-20(31)30-25-27(32-17-21-11-5-2-6-12-21)26-24(19-34-28(36-26)23-15-9-4-10-16-23)35-29(25)33-18-22-13-7-3-8-14-22/h2-16,24-29H,17-19H2,1H3,(H,30,31)/t24?,25-,26+,27+,28?,29+/m0/s1
Synonyms:- 2-Acetamido-1,3-di-O-benzyl-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside
- Benzyl 2-acetamido-3-O-benzyl-4,6-O-benzylidene-2-deoxy--D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
β-D-Glucopyranoside, phenylmethyl 2-(acetylamino)-2-deoxy-3-O-(phenylmethyl)-4,6-O-(phenylmethylene)-
CAS:Formula:C29H31NO6Color and Shape:SolidMolecular weight:489.55952-Acetamido-1,3-di-O-benzyl-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside
CAS:2-Acetamido-1,3-di-O-benzyl-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside is a modification of a carbohydrate. It is a complex carbohydrate that has been synthesized by custom synthesis. It is an oligosaccharide with high purity and monosaccharides methylated at the hydroxyl group. The glycosylation and polysaccharide have been synthesized with fluorination and saccharides.Formula:C29H31NO6Purity:Min. 95%Molecular weight:489.56 g/mol


