CAS 140429-37-4
:RK 286D
Description:
RK 286D, identified by its CAS number 140429-37-4, is a chemical compound that falls within the category of synthetic organic compounds. While specific details about its characteristics may not be widely available, compounds like RK 286D are typically evaluated based on their molecular structure, physical properties, and potential applications. Generally, such substances may exhibit unique solubility profiles, stability under various conditions, and reactivity with other chemicals. They may also possess specific functional groups that influence their behavior in chemical reactions. Additionally, RK 286D could be utilized in various fields, including pharmaceuticals, agrochemicals, or materials science, depending on its properties. Safety data sheets and regulatory information would provide insights into its toxicity, handling precautions, and environmental impact. For precise characteristics, including molecular weight, boiling point, and specific applications, consulting specialized chemical databases or literature is recommended.
Formula:C26H23N3O4
InChI:InChI=1/C26H23N3O4/c1-11-26(32)19(31)8-20(33-11)13-3-2-4-18-22(13)23-16-10-27-9-15(16)21-14-7-12(30)5-6-17(14)28-24(21)25(23)29-18/h2,4,7,9-11,13,19-20,26,31-32H,3,5-6,8H2,1H3/t11-,13?,19+,20-,26-/m1/s1
Synonyms:- RK-286D
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
RK 286D
CAS:RK 286D is an indolocarbazole antibiotic.
Formula:C26H23N3O4Color and Shape:SolidMolecular weight:441.48
