CymitQuimica logo

CAS 14045-23-9

:

3-Methylpyridine-4-sulfonic acid

Description:
3-Methylpyridine-4-sulfonic acid, with the CAS number 14045-23-9, is an organic compound that features a pyridine ring substituted with a methyl group and a sulfonic acid group. This compound is characterized by its aromatic nature, which contributes to its stability and reactivity. The presence of the sulfonic acid group (-SO3H) imparts strong acidic properties, making it a useful reagent in various chemical reactions, particularly in organic synthesis and catalysis. It is typically soluble in water due to the polar sulfonic acid group, which enhances its utility in aqueous environments. Additionally, 3-methylpyridine-4-sulfonic acid can participate in electrophilic substitution reactions, and its derivatives may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact. Overall, this compound serves as a valuable building block in synthetic organic chemistry.
Formula:C6H7NO3S
InChI:InChI=1/C6H7NO3S/c1-5-4-7-3-2-6(5)11(8,9)10/h2-4H,1H3,(H,8,9,10)
SMILES:Cc1cnccc1S(=O)(=O)O
Synonyms:
  • 3-Methypyridine-4-Sulfonic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.