CAS 140472-69-1: 3-BROMO-5-HYDROXYBENZOIC ACID

Description:3-Bromo-5-hydroxybenzoic acid is an aromatic compound characterized by the presence of a bromine atom and a hydroxyl group on a benzoic acid framework. Its molecular structure features a benzene ring with a carboxylic acid group (-COOH) and hydroxyl group (-OH) positioned at the 5 and 3 positions, respectively. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl and carboxylic acid functional groups. It exhibits properties typical of phenolic compounds, including potential antioxidant activity. The bromine substituent can influence the compound's reactivity and biological activity, making it of interest in various fields such as pharmaceuticals and agrochemicals. Additionally, 3-bromo-5-hydroxybenzoic acid can participate in various chemical reactions, including electrophilic aromatic substitution and esterification, which are valuable in synthetic organic chemistry. Its CAS number, 140472-69-1, is used for identification in chemical databases and regulatory contexts.

Formula:C₇H₅BrO₃

InChI:InChI=1/C7H5BrO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9H,(H,10,11)

Found 5 products.

Product data	Purity	Price range	Estimated delivery
3-Bromo-5-hydroxybenzoic Acid REF: 3B-B4740CAS: 140472-69-1	>98.0%(GC)(T)	50.00 €~137.00 €	Tue 01 Apr 25
Benzoic acid, 3-bromo-5-hydroxy- REF: IN-DA001CI9CAS: 140472-69-1	96%	25.00 €~555.00 €	Tue 08 Apr 25
3-Bromo-5-hydroxybenzoic acid REF: 10-F210991CAS: 140472-69-1	95.0%	32.00 €~312.00 €	Fri 11 Apr 25
3-Bromo-5-hydroxybenzoic acid REF: 54-OR20019CAS: 140472-69-1	97%	37.00 €~5,102.00 €	Tue 15 Apr 25
3-Bromo-5-hydroxybenzoic acid REF: 3D-FB34139CAS: 140472-69-1	Min. 95%	143.00 €~2,769.00 €	Mon 21 Apr 25