CAS 140472-69-1
:3-BROMO-5-HYDROXYBENZOIC ACID
Description:
3-Bromo-5-hydroxybenzoic acid is an aromatic compound characterized by the presence of a bromine atom and a hydroxyl group on a benzoic acid framework. Its molecular structure features a benzene ring with a carboxylic acid group (-COOH) and hydroxyl group (-OH) positioned at the 5 and 3 positions, respectively. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl and carboxylic acid functional groups. It exhibits properties typical of phenolic compounds, including potential antioxidant activity. The bromine substituent can influence the compound's reactivity and biological activity, making it of interest in various fields such as pharmaceuticals and agrochemicals. Additionally, 3-bromo-5-hydroxybenzoic acid can participate in various chemical reactions, including electrophilic aromatic substitution and esterification, which are valuable in synthetic organic chemistry. Its CAS number, 140472-69-1, is used for identification in chemical databases and regulatory contexts.
Formula:C7H5BrO3
InChI:InChI=1/C7H5BrO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9H,(H,10,11)
SMILES:c1c(cc(cc1Br)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-5-hydroxybenzoic Acid
CAS:Formula:C7H5BrO3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:217.02Benzoic acid, 3-bromo-5-hydroxy-
CAS:Formula:C7H5BrO3Purity:95%Color and Shape:SolidMolecular weight:217.0168Ref: IN-DA001CI9
1g32.00€5g70.00€10g105.00€1kgTo inquire25g166.00€50g233.00€100g608.00€250gTo inquire500gTo inquire100mg25.00€250mg24.00€3-Bromo-5-hydroxybenzoic acid
CAS:3-Bromo-5-hydroxybenzoic acidPurity:97%Color and Shape:SolidMolecular weight:217.0168g/mol3-Bromo-5-hydroxybenzoic acid
CAS:3-Bromo-5-hydroxybenzoic acid is a metabolite of 3,5-dihydroxybenzoic acid (DHB) in the metabolism of benzoic acid. It has been shown to be an antibacterial agent and has been used to treat metabolic disorders in hamsters. Symptoms of 3-bromo-5-hydroxybenzoic acid include dyslipidemia, which can lead to metabolic disorders such as diabetes mellitus and atherosclerosis. The compound may also have a role in tuberculosis and cancer due to its ability to induce apoptosis.
Formula:C7H5O3BrPurity:Min. 95%Color and Shape:White PowderMolecular weight:217.02 g/mol3-Bromo-5-hydroxybenzoic acid
CAS:Formula:C7H5BrO3Purity:95%Color and Shape:Solid, Powder or Crystalline Powder or SolidMolecular weight:217.018




