CAS 140480-89-3
:3,5-Difluorobenzenesulfonamide
Description:
3,5-Difluorobenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring that has two fluorine atoms substituted at the 3 and 5 positions. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its ability to act as a sulfonamide antibiotic or as a building block in drug synthesis. The presence of fluorine atoms enhances the compound's lipophilicity and metabolic stability, which can influence its biological activity. Additionally, the sulfonamide group contributes to its solubility in polar solvents, making it versatile in various chemical reactions. The compound's molecular structure allows for specific interactions with biological targets, which is essential in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices.
Formula:C6H5F2NO2S
InChI:InChI=1/C6H11FO5/c7-3-4(9)2(1-8)12-6(11)5(3)10/h2-6,8-11H,1H2
SMILES:C(C1C(C(C(C(O)O1)O)F)O)O
Synonyms:- 3,5-Difluorobenzenesulphonamide
- 3-Deoxy-3-Fluorohexopyranose
- BUTTPARK 27\07-04
- Benzenesulfonamide, 3,5-difluoro-(9CI)
- 3,5-DIFLUOROBENZENESULFONAMIDE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Difluorobenzenesulfonamide, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H5F2NO2SPurity:98%Color and Shape:Crystals or powder or crystalline powder, White to pale cream to pale brownMolecular weight:193.17Benzenesulfonamide, 3,5-difluoro-
CAS:Formula:C6H5F2NO2SPurity:97%Color and Shape:SolidMolecular weight:193.17123,5-Difluorobenzenesulphonamide
CAS:3,5-DifluorobenzenesulphonamideFormula:C6H5F2NO2SPurity:≥95%Color and Shape: faint beige powderMolecular weight:193.17g/mol3,5-Difluorobenzenesulfonamide
CAS:Formula:C6H5F2NO2SPurity:97%Color and Shape:SolidMolecular weight:193.17



