
CAS 1405-59-0
:2C-O-De[O-β-D-arabinopyranosyl-(1→2)-O-α-D-mannopyranosyl-(1→2)]ristomycin A
Description:
2C-O-De[O-β-D-arabinopyranosyl-(1→2)-O-α-D-mannopyranosyl-(1→2)]ristomycin A is a complex glycosylated antibiotic belonging to the ristocetin family, which is derived from the fermentation of certain actinobacteria. This compound exhibits a unique structure characterized by multiple sugar moieties attached to the core antibiotic structure, enhancing its biological activity and specificity. It is known for its antimicrobial properties, particularly against Gram-positive bacteria, and has been studied for its potential use in treating infections caused by resistant strains. The presence of the arabinopyranosyl and mannosyl groups contributes to its solubility and interaction with bacterial cell walls. Additionally, the compound's mechanism of action typically involves inhibition of protein synthesis, making it effective against a range of pathogens. Its complex structure and specific glycosylation patterns are crucial for its pharmacological properties, influencing both its efficacy and safety profile in clinical applications. As with many antibiotics, resistance can develop, necessitating ongoing research into its use and alternatives.
Formula:C84H92N8O35
InChI:InChI=1S/C84H92N8O35/c1-28-45(97)18-35-20-46(28)122-47-19-33(9-16-44(47)96)55(86)75(109)91-60-64(100)31-5-11-38(12-6-31)120-49-21-36-22-50(74(49)127-84-72(108)69(105)66(102)52(125-84)27-117-82-70(106)67(103)63(99)30(3)119-82)121-39-13-7-32(8-14-39)73(126-53-25-42(85)62(98)29(2)118-53)61-80(114)90-59(81(115)116-4)41-23-37(94)24-48(123-83-71(107)68(104)65(101)51(26-93)124-83)54(41)40-17-34(10-15-43(40)95)56(76(110)92-61)87-78(112)58(36)88-77(111)57(35)89-79(60)113/h5-24,29-30,42,51-53,55-73,82-84,93-108H,25-27,85-86H2,1-4H3,(H,87,112)(H,88,111)(H,89,113)(H,90,114)(H,91,109)(H,92,110)
InChI key:InChIKey=YECWLNHQVUKZLG-UHFFFAOYSA-N
SMILES:O(C1=C2C(C(C(OC)=O)NC(=O)C3C(OC4CC(N)C(O)C(C)O4)C=5C=CC(=CC5)OC=6C=C7C(C(=O)NC(C=8C=C2C(O)=CC8)C(=O)N3)NC(=O)C9C=%10C=C(OC=%11C=C(C(N)C(=O)NC(C(=O)N9)C(O)C=%12C=CC(OC(=C7)C6OC%13OC(COC%14C(O)C(O)C(O)C(C)O%14)C(O)C(O)C%13O)=CC%12)C=CC%11O)C(C)=C(O)C%10)=CC(O)=C1)C%15OC(CO)C(O)C(O)C%15O
Synonyms:- Ristomycin A, 2C-O-de[O-β-D-arabinopyranosyl-(1→2)-O-α-D-mannopyranosyl-(1→2)]-
- Ristomycin B
- 2C-O-De[O-β-D-arabinopyranosyl-(1→2)-O-α-D-mannopyranosyl-(1→2)]ristomycin A
- 1H,15H,34H-20,23:30,33-Dietheno-3,18:35,48-bis(iminomethano)-4,8:10,14:25,28:43,47-tetrametheno-28H-[1,14,6,22]dioxadiazacyclooctacosino[4,5-m][10,2,16]benzoxadiazacyclotetracosine, ristomycin A deriv.
- Ristocetin B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ristocetin B
CAS:Ristocetin B is a biochemical.Formula:C84H92N8O35Color and Shape:SolidMolecular weight:1773.681
