CAS 14055-44-8

4-BROMONONAFLUORODIPHENYL ETHER

Description:

4-Bromononafluorodiphenyl ether is an organic compound characterized by its unique structure, which includes a bromine atom and a nonafluorinated diphenyl ether moiety. This compound features a biphenyl structure where one of the phenyl rings is substituted with a bromine atom, while the other is fully fluorinated with nine fluorine atoms, contributing to its distinctive chemical properties. The presence of both bromine and fluorine atoms imparts significant polarity and potential reactivity, making it of interest in various chemical applications, including materials science and organic synthesis. Its high fluorine content typically results in low surface energy and high thermal stability, which can be advantageous in specific industrial applications. Additionally, the compound may exhibit unique solubility characteristics and environmental persistence due to the fluorinated groups. Safety and handling considerations are essential, as halogenated compounds can pose environmental and health risks. Overall, 4-bromononafluorodiphenyl ether represents a specialized class of halogenated organic compounds with potential utility in advanced chemical applications.

Formula: C₁₂BrF₉O

InChI: InChI=1/C12BrF9O/c13-1-2(14)7(19)11(8(20)3(1)15)23-12-9(21)5(17)4(16)6(18)10(12)22

SMILES: c1(c(c(c(c(c1F)F)Oc1c(c(c(c(c1F)F)F)F)F)F)F)Br

Synonyms:

• 1-Bromo-2,3,5,6-tetrafluoro-4-(pentafluorophenoxy)benzene
• 4-Bromo-2,3,5,6-tetrafluorophenyl pentafluorophenyl ether
• Benzene, 1-Bromo-2,3,5,6-Tetrafluoro-4-(2,3,4,5,6-Pentafluorophenoxy)-

4-Bromoperfluorodiphenyl ether

CAS: 14055-44-8

4-Bromoperfluorodiphenyl ether

Purity: ≥95%

Molecular weight: 411.02g/mol

Ref: 54-PC6629