CAS 140615-77-6
:[(2S,4R,6S)-4-benzyloxy-2-(benzyloxymethyl)-5-(1,3-dioxoisoindolin-2-yl)-6-(4-methoxyphenoxy)tetrahydropyran-3-yl] acetate
Description:
The chemical substance with the name "[(2S,4R,6S)-4-benzyloxy-2-(benzyloxymethyl)-5-(1,3-dioxoisoindolin-2-yl)-6-(4-methoxyphenoxy)tetrahydropyran-3-yl] acetate" and CAS number "140615-77-6" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as benzyloxy, methoxy, and dioxoisoindolin moieties. This compound features a tetrahydropyran ring, which contributes to its cyclic nature and stereochemistry, indicated by the specific stereochemical descriptors (2S, 4R, 6S). The presence of acetate suggests it has an ester functional group, which can influence its reactivity and solubility. The compound's structure implies potential applications in medicinal chemistry, possibly as a lead compound for drug development, due to the presence of diverse functional groups that may interact with biological targets. Its synthesis and characterization would typically involve techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm purity and structural integrity. Overall, this compound exemplifies the complexity often found in organic molecules used in pharmaceutical research.
Formula:C37H35NO9
InChI:InChI=1/C37H35NO9/c1-24(39)45-33-31(23-43-21-25-11-5-3-6-12-25)47-37(46-28-19-17-27(42-2)18-20-28)32(34(33)44-22-26-13-7-4-8-14-26)38-35(40)29-15-9-10-16-30(29)36(38)41/h3-20,31-34,37H,21-23H2,1-2H3/t31-,32?,33?,34+,37+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
β-D-Glucopyranoside, 4-methoxyphenyl 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-3,6-bis-O-(phenylmethyl)-, 4-acetate
CAS:Formula:C37H35NO9Purity:98%Color and Shape:SolidMolecular weight:637.67514-Methoxyphenyl 4-O-Acetyl-3,6-di-O-benzyl-2-deoxy-2-phthalimido-β-D-glucopyranoside
CAS:4-Methoxyphenyl 4-O-Acetyl-3,6-di-O-benzyl-2-deoxy-2-phthalimido-β-D-glucopyranosidePurity:>98.0%4-Methoxyphenyl 4-O-Acetyl-3,6-di-O-benzyl-2-deoxy-2-phthalimido-β-D-glucopyranoside
CAS:Formula:C37H35NO9Purity:>98.0%(HPLC)(NMR)Color and Shape:White to Almost white powder to crystalMolecular weight:637.694-Methoxyphenyl 4-O-Acetyl-3,6-di-O-benzyl-2-deoxy-2-phthalimido-b-D-glucopyranoside
CAS:4-Methoxyphenyl 4-O-acetyl-3,6-di-O-benzyl-2-deoxy-2-phthalimido--b-D--glucopyranoside is a synthetic carbohydrate that has been modified with fluorine. It has the chemical formula of C24H21F7NO8P and a molecular weight of 592.56. This compound is used for the synthesis of glycosides and as an intermediate for the synthesis of saccharides and oligosaccharides.Formula:C37H35NO9Purity:Min. 95%Molecular weight:637.68 g/mol



