CAS 14062-59-0
:Glucofrangulin B
Description:
Glucofrangulin B is a naturally occurring compound classified as a glycoside, specifically derived from the plant genus Rheum, commonly known as rhubarb. It is characterized by its structure, which includes a glucose moiety linked to an anthraquinone derivative. This compound is known for its potential pharmacological properties, including laxative effects, which are attributed to its ability to stimulate intestinal motility. Glucofrangulin B is often studied for its role in traditional medicine and its potential applications in herbal remedies. In terms of solubility, it is generally soluble in polar solvents, which is typical for glycosides. The compound may also exhibit antioxidant properties, contributing to its therapeutic potential. However, like many natural products, its bioactivity can be influenced by factors such as extraction methods and the specific plant source. As with any bioactive compound, further research is necessary to fully understand its mechanisms of action and potential health benefits.
Formula:C26H28O14
InChI:InChI=1S/C26H28O14/c1-10-2-12-17(14(29)3-10)21(32)18-13(19(12)30)4-11(40-26(36)9-37-8-25(26,35)7-28)5-15(18)38-24-23(34)22(33)20(31)16(6-27)39-24/h2-5,16,20,22-24,27-29,31,33-36H,6-9H2,1H3
InChI key:InChIKey=SOAOUDVXSAIAHD-UHFFFAOYSA-N
SMILES:O=C1C=2C(=C(OC3OC(CO)C(O)C(O)C3O)C=C(OC4(O)C(CO)(O)COC4)C2)C(=O)C=5C1=CC(C)=CC5O
Synonyms:- 3-(<span class="text-smallcaps">D</smallcap>-Apio-β-<smallcap>D</smallcap>-furanosyloxy)-1-(β-<smallcap>D</span>-glucopyranosyloxy)-8-hydroxy-6-methyl-9,10-anthracenedione
- 3-(D-Apio-beta-D-furanosyloxy)-1-(beta-D-glucopyranosyloxy)-8-hydroxy-6-methylanthraquinone
- 8-Hydroxy-6-Methyl-9,10-Dioxo-3-(Pentofuranosyloxy)-9,10-Dihydroanthracen-1-Yl Hexopyranoside
- 9,10-Anthracenedione, 3-(<span class="text-smallcaps">D</smallcap>-apio-β-<smallcap>D</smallcap>-furanosyloxy)-1-(β-<smallcap>D</span>-glucopyranosyloxy)-8-hydroxy-6-methyl-
- 9,10-Anthracenedione, 3-(D-apio-beta-D-furanosyloxy)-1-(beta-D-glucopyranosyloxy)-8-hydroxy-6-methyl-
- Glucofrangulin B
- Glucofranqulin B
- 9,10-Anthracenedione, 3-(D-apio-β-D-furanosyloxy)-1-(β-D-glucopyranosyloxy)-8-hydroxy-6-methyl-
- 3-(D-Apio-β-D-furanosyloxy)-1-(β-D-glucopyranosyloxy)-8-hydroxy-6-methyl-9,10-anthracenedione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
9,10-Anthracenedione, 3-(D-apio-β-D-furanosyloxy)-1-(β-D-glucopyranosyloxy)-8-hydroxy-6-methyl-
CAS:Formula:C26H28O14Molecular weight:564.4921Glucofrangulin B
CAS:Glucofrangulin B is an anthraquinone glycoside, which is a chemical compound primarily derived from the Rhamnus frangula plant, commonly known as alder buckthorn. This compound is categorized as a natural product found in certain species of plants, particularly those belonging to the Rhamnaceae family. Glucofrangulin B functions through its hydrolysis to form the active aglycone, emodin, which subsequently exerts laxative effects by stimulating peristalsis in the intestines and increasing the water content in the stool.Formula:C26H28O14Purity:Min. 95%Color and Shape:PowderMolecular weight:564.49 g/mol


