
CAS 140626-81-9
:Octacosanamide
Description:
Octacosanamide, with the CAS number 140626-81-9, is a long-chain fatty amide derived from octacosanoic acid, which consists of a straight-chain hydrocarbon with 28 carbon atoms. This compound is characterized by its waxy solid state at room temperature, exhibiting low solubility in water due to its hydrophobic nature, while being more soluble in organic solvents. Octacosanamide is known for its potential applications in various fields, including as a surfactant, emulsifier, and in the formulation of personal care products. It possesses a high melting point, indicative of its long carbon chain, and exhibits thermal stability, making it suitable for high-temperature applications. Additionally, octacosanamide can participate in hydrogen bonding due to the presence of the amide functional group, which may influence its interactions in biological systems. Its structural properties contribute to its utility in enhancing the texture and stability of formulations, as well as its potential role in drug delivery systems. Overall, octacosanamide is a versatile compound with significant industrial and research relevance.
Formula:C28H57NO
InChI:InChI=1S/C28H57NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h2-27H2,1H3,(H2,29,30)
InChI key:InChIKey=MYSPBSKLIFPWDI-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCCC)CCCCCCCCC(N)=O
Synonyms:- Octacosanamide
- Montanamide
- Montanic acid amide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
