CAS 14064-13-2
:1-HYDROXYMETHYL-1-METHYLCYCLOHEXANE
Description:
1-Hydroxymethyl-1-methylcyclohexane, with the CAS number 14064-13-2, is an organic compound characterized by its cyclohexane structure, which features a hydroxymethyl group (-CH2OH) and a methyl group (-CH3) attached to the same carbon atom. This compound is a colorless to pale yellow liquid at room temperature and is typically insoluble in water due to its hydrophobic cyclohexane ring. It exhibits moderate volatility and can have a distinct odor. The presence of the hydroxymethyl group introduces some polarity, which can influence its reactivity and interactions with other substances. 1-Hydroxymethyl-1-methylcyclohexane can participate in various chemical reactions, including oxidation and substitution reactions, making it of interest in organic synthesis and industrial applications. Safety data indicates that, like many organic solvents, it should be handled with care, as it may pose health risks upon inhalation or skin contact. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C8H16O
InChI:InChI=1/C8H16O/c1-8(7-9)5-3-2-4-6-8/h9H,2-7H2,1H3
SMILES:CC1(CCCCC1)CO
Synonyms:- (1-Methylcyclohexanyl)Methanol
- Cyclohexanemethanol, 1-methyl-
- (1-Methylcyclohexyl)Methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cyclohexanemethanol, 1-methyl-
CAS:Formula:C8H16OPurity:95%Color and Shape:LiquidMolecular weight:128.2120(1-Methylcyclohexyl)methanol
CAS:(1-Methylcyclohexyl)methanolPurity:97%Color and Shape:LiquidMolecular weight:128.21g/mol1-Hydroxymethyl-1-methylcyclohexane
CAS:1-Hydroxymethyl-1-methylcyclohexane is a biodiesel that has been shown to be a good solvent for nonpolar compounds and can also be used as a reaction medium in organic synthesis. It has a relatively high boiling point and is soluble in both water and other nonpolar solvents. 1-Hydroxymethyl-1-methylcyclohexane is also known for its conformational properties and ability to bind to fatty acids, which are the main components of biodiesel.Formula:C8H16OPurity:Min. 95%Color and Shape:PowderMolecular weight:128.21 g/mol1-Hydroxymethyl-1-methylcyclohexane
CAS:Controlled ProductFormula:C8H16OColor and Shape:NeatMolecular weight:128.21




