CAS 140645-53-0
:2-AMINOMETHYL-4-BOC-MORPHOLINE
Description:
2-Aminomethyl-4-BOC-morpholine is a chemical compound characterized by its morpholine structure, which includes a morpholine ring substituted with an aminomethyl group and a tert-butyloxycarbonyl (BOC) protecting group. The BOC group is commonly used in organic synthesis to protect amines during reactions, making this compound valuable in pharmaceutical and medicinal chemistry applications. The presence of the amino group allows for further functionalization, while the morpholine ring contributes to the compound's potential biological activity. This compound is typically a white to off-white solid and is soluble in various organic solvents. Its molecular structure suggests it may exhibit properties such as basicity due to the amino group and potential reactivity in nucleophilic substitution reactions. As with many chemical substances, handling should be done with care, following appropriate safety protocols, as it may pose health risks if ingested or inhaled. Overall, 2-aminomethyl-4-BOC-morpholine serves as an important intermediate in the synthesis of more complex molecules in the field of organic chemistry.
Formula:C10H20N2O3
InChI:InChI=1/C10H20N2O3/c1-10(2,3)15-9(13)12-4-5-14-8(6-11)7-12/h8H,4-7,11H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCOC(CN)C1
Synonyms:- Tert-Butyl 2-(Aminomethyl)Morpholine-4-Carboxylate
- Tertio-Butyl 2-(Aminomethyl)Morpholine-4-Carboxylate
- 2-(Aminomethyl)Morpholine, 4-Boc Protected
- Buttpark 90\06-25
- 4-Boc-2-Aminomethylmorpholine
- 2-Aminomethyl-morpholine-4-carboxylic acid tert-butyl ester
- 4-N-Boc-2-(2-aminoethyl)morpholine
- 4-N-Boc-3-aminomethylmorpholine
- N-Boc-2-aminomethylmorpholine
- Tert-Butyl 2-(Aminomethyl)Morpholine-4-Carboxylatato
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Morpholinecarboxylic acid, 2-(aminomethyl)-, 1,1-dimethylethyl ester
CAS:Formula:C10H20N2O3Purity:95%Color and Shape:SolidMolecular weight:216.27742-(Aminomethyl)morpholine, 4-BOC protected
CAS:2-(Aminomethyl)morpholine, 4-BOC protectedPurity:95%Color and Shape:SolidMolecular weight:216.28g/mol4-Boc-2-Aminomethylmorpholine
CAS:Formula:C10H20N2O3Purity:95%Color and Shape:SolidMolecular weight:216.2812-Aminomethyl-4-boc-morpholine
CAS:Please enquire for more information about 2-Aminomethyl-4-boc-morpholine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C10H20N2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:216.28 g/mol



