CAS 140667-42-1
:matlystatin F
Description:
Matlystatin F, with the CAS number 140667-42-1, is a natural product that belongs to the class of compounds known as polyketides. It is derived from certain microbial sources and exhibits notable biological activity, particularly as an inhibitor of specific enzymes involved in cellular processes. The compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its reactivity and interaction with biological targets. Matlystatin F has garnered interest in medicinal chemistry due to its potential therapeutic applications, particularly in the context of cancer research and other diseases where enzyme inhibition plays a crucial role. Its mechanism of action typically involves the modulation of signaling pathways, making it a subject of study for drug development. Additionally, the compound's stability, solubility, and bioavailability are important factors that influence its efficacy and application in pharmacological contexts. Overall, matlystatin F represents a significant area of research within the field of natural product chemistry and drug discovery.
Formula:C27H44N6O6
InChI:InChI=1/C27H44N6O6/c1-4-6-7-10-19(17-23(34)30-39)26(36)33-21(11-8-14-28-33)25(35)29-24(18(3)5-2)20-13-16-32-22(27(37)38)12-9-15-31(20)32/h13,16,18-19,21-22,24,28H,4-12,14-15,17H2,1-3H3,(H3-,29,30,34,35,37,38,39)
Synonyms:- [(3-{[6-{[1-(5-carboxy-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-4-ium-1-yl)-2-methylbutyl]carbamoyl}tetrahydropyridazin-1(2H)-yl]carbonyl}octanoyl)amino]oxidanide
- Matlystatin F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Matlystatin F
CAS:<p>Matlystatin F is an inhibitor of metalloproteinases (MMP).</p>Formula:C27H44N6O6Color and Shape:SolidMolecular weight:548.675
