CAS 14068-78-1

5-(2-dimethylaminoethyl)-1,3,4-thiadiazol-2-amine

Description:

5-(2-Dimethylaminoethyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a dimethylaminoethyl side chain. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as potential basicity due to the presence of the amino group. It may also display moderate solubility in polar solvents, influenced by the dimethylamino group. The thiadiazole moiety can contribute to biological activity, making this compound of interest in pharmaceutical research. Its reactivity may include nucleophilic substitution and potential interactions with electrophiles, which are common in compounds containing nitrogen and sulfur. Additionally, the presence of the dimethylamino group may enhance lipophilicity, affecting its pharmacokinetic properties. Overall, 5-(2-dimethylaminoethyl)-1,3,4-thiadiazol-2-amine is a compound with potential applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₆H₁₂N₄S

InChI: InChI=1/C6H12N4S/c1-10(2)4-3-5-8-9-6(7)11-5/h3-4H2,1-2H3,(H2,7,9)

SMILES: CN(C)CCc1n[nH]c(=N)s1

5-[2-(dimethylamino)ethyl]-1,3,4-thiadiazol-2-amine

CAS: 14068-78-1

Formula: C₆H₁₂N₄S

Molecular weight: 172.2513

Ref: IN-DA001CON

5-[2-(dimethylamino)ethyl]-1,3,4-thiadiazol-2-amine

CAS: 14068-78-1

Formula: C₆H₁₂N₄S

Purity: 95.0%

Molecular weight: 172.25

Ref: 10-F314738