CAS 140690-56-8

2,4-bis(trifluoromethyl)benzyl bromide

Description:

2,4-bis(trifluoromethyl)benzyl bromide is an organic compound characterized by its unique structure, which features a benzyl group substituted with two trifluoromethyl groups at the 2 and 4 positions, along with a bromine atom attached to the benzyl carbon. This compound is notable for its high electronegativity due to the presence of trifluoromethyl groups, which can significantly influence its reactivity and interactions with other chemical species. It is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, including nucleophilic substitutions. The presence of bromine makes it a good leaving group, facilitating reactions such as coupling and halogenation. Additionally, the trifluoromethyl groups enhance the compound's lipophilicity and stability, making it suitable for applications in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks and environmental concerns.

Formula: C₉H₅BrF₆

InChI: InChI=1/C9H5BrF6/c10-4-5-1-2-6(8(11,12)13)3-7(5)9(14,15)16/h1-3H,4H2

SMILES: c1cc(cc(c1CBr)C(F)(F)F)C(F)(F)F

Synonyms:

• 1-(Bromomethyl)-2,4-Bis(Trifluoromethyl)Benzene

2,4-Bis(trifluoromethyl)benzyl bromide, 97%

CAS: 140690-56-8

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₉H₅BrF₆

Purity: 97%

Color and Shape: Clear colorless, Liquid

Molecular weight: 307.03

Ref: 02-B23910

Benzene, 1-(bromomethyl)-2,4-bis(trifluoromethyl)-

CAS: 140690-56-8

Formula: C₉H₅BrF₆

Purity: 95%

Color and Shape: Liquid

Molecular weight: 307.0304

Ref: IN-DA001CP3

2,4-Bis(trifluoromethyl)benzyl bromide

CAS: 140690-56-8

2,4-Bis(trifluoromethyl)benzyl bromide

Formula: C₉H₅BrF₆

Purity: ≥95%

Color and Shape: clear. colourless liquid

Molecular weight: 307.03g/mol

Ref: 54-PC3104T

2,4-Bis(trifluoromethyl)benzyl bromide

CAS: 140690-56-8

Formula: C₉H₅BrF₆

Purity: 95%(GC-MS);RG

Color and Shape: Liquid

Molecular weight: 307.033

Ref: 10-F006022