CAS 140695-49-4
:8-Hydroxy Mianserin b-D-Glucuronide
Description:
8-Hydroxy Mianserin β-D-Glucuronide is a chemical compound that serves as a metabolite of the antidepressant drug mianserin. It is characterized by the presence of a hydroxyl group at the 8-position of the mianserin structure, which is a tetracyclic compound. The glucuronide moiety indicates that this compound is a conjugate formed through the process of glucuronidation, a common phase II metabolic reaction that enhances the solubility of lipophilic substances, facilitating their excretion from the body. This compound is typically studied in the context of pharmacokinetics and drug metabolism, particularly regarding its role in the biotransformation of mianserin. Its properties may include moderate solubility in water due to the glucuronide group, and it may exhibit biological activity related to its parent compound, although its specific pharmacological effects are less well-documented. Overall, 8-Hydroxy Mianserin β-D-Glucuronide is significant in understanding the metabolic pathways of antidepressants and their potential effects on human health.
Formula:C24H28N2O7
InChI:InChI=1/C24H28N2O7/c1-25-8-9-26-17-5-3-2-4-13(17)10-14-11-15(6-7-16(14)18(26)12-25)32-24-21(29)19(27)20(28)22(33-24)23(30)31/h2-7,11,18-22,24,27-29H,8-10,12H2,1H3,(H,30,31)
SMILES:CN1CCN2c3ccccc3Cc3cc(ccc3C2C1)OC1C(C(C(C(C(=O)O)O1)O)O)O
Synonyms:- 1,2,3,4,10,14b-Hexahydro-2-methyldibenzo[c,f]pyrazino[1,2-a]azepin-8-yl b-D-Glucopyranosiduronic Acid
- 1,2,3,4,10,14b-Hexahydro-2-methyldibenzo[c,f]pyrazino[1,2-a]azepin-8-yl -D-Glucopyranosiduronic Acid
- 8-Hydroxy Mianserin -D-Glucuronide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
β-D-Glucopyranosiduronic acid, 1,2,3,4,10,14b-hexahydro-2-methyldibenzo[c,f]pyrazino[1,2-a]azepin-8-yl
CAS:Formula:C24H28N2O7Molecular weight:456.48838-Hydroxymianserin b-D-glucuronide
CAS:<p>8-Hydroxymianserin b-D-glucuronide is a synthetic, fluorinated glycosylated analog of mianserin. It is a white to off-white powder that is soluble in water and methanol. This compound has been studied as a potential antihypertensive agent, but was never marketed. 8-Hydroxymianserin b-D-glucuronide is used in the synthesis of glycosylated oligosaccharides with click modification.</p>Formula:C24H28N2O7Purity:Min. 95%Molecular weight:456.5 g/mol


