
CAS 140710-94-7: (εR,1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-Hydroxy-2-(methylene-d2)cyclohexylidene]ethylidene-2-d]octahydro-α,α,ε,7a-tetramethyl-1H-indene-1-pentanol
Description:The chemical substance with the name "(εR,1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-Hydroxy-2-(methylene-d2)cyclohexylidene]ethylidene-2-d]octahydro-α,α,ε,7a-tetramethyl-1H-indene-1-pentanol" and CAS number "140710-94-7" is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a bicyclic structure with a hydroxyl group, indicating potential for hydrogen bonding and solubility in polar solvents. The presence of multiple methyl groups suggests a degree of hydrophobicity, which may influence its interactions in biological systems. The compound's stereochemical configuration, denoted by the specific R and S designations, implies that it may exhibit chiral properties, potentially leading to different biological activities or reactivities depending on its isomeric form. Additionally, the presence of a cyclohexylidene moiety indicates potential for conformational flexibility, which can affect its overall stability and reactivity. Overall, this compound's unique structure and functional groups suggest it may have applications in fields such as pharmaceuticals or materials science, although specific properties would require empirical investigation.
Formula:C27H41D3O2
InChI:InChI=1S/C27H44O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h11-12,20,23-25,28-29H,1,6-10,13-18H2,2-5H3/b21-11+,22-12-/t20-,23+,24-,25+,27-/m1/s1/i1D2,12D
InChI key:InChIKey=JWUBBDSIWDLEOM-CMMPNOGOSA-N
SMILES:OC1CC(=CC=C2CCCC3(C)C2CCC3C(C)CCCC(O)(C)C)C(=C)CC1
- Synonyms:
- (εR,1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-Hydroxy-2-(methylene-d2)cyclohexylidene]ethylidene-2-d]octahydro-α,α,ε,7a-tetramethyl-1H-indene-1-pentanol
- 6,19,19-Trideutero-25-hydroxyvitamin D3
- 1H-Indene-1-pentanol, 4-[(2Z)-2-[(5S)-5-hydroxy-2-(methylene-d2)cyclohexylidene]ethylidene-2-d]octahydro-α,α,ε,7a-tetramethyl-, (εR,1R,3aS,4E,7aR)-
- 9,10-Secocholesta-5,7,10(19)-triene-6,19,19-d3-3,25-diol, (3β,5Z,7E)-
- 25-Hydroxyvitamin D3-(6,19,19-d3)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 25-HydroxyvitaMin D3-[D3] Calcifediol-D3 REF: IN-DA009Y8ICAS: 140710-94-7 | 99% | To inquire | Tue 25 Mar 25 |
![]() | Calcifediol-d3 (25-Hydroxy Vitamin D3-d3) REF: 4Z-C-273009CAS: 140710-94-7 | - - - | To inquire | Tue 01 Apr 25 |

25-HydroxyvitaMin D3-[D3] Calcifediol-D3
Ref: IN-DA009Y8I
1mg | To inquire |

Ref: 4Z-C-273009
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |