CymitQuimica logo

CAS 1407521-98-5

:

Methyl 7-ethoxy-2-benzofurancarboxylate

Description:
Methyl 7-ethoxy-2-benzofurancarboxylate is an organic compound characterized by its benzofuran structure, which is a fused ring system consisting of a benzene ring and a furan ring. This compound features an ethoxy group and a methyl ester functional group, contributing to its chemical reactivity and solubility properties. Typically, compounds of this nature exhibit moderate polarity due to the presence of both hydrophobic aromatic and hydrophilic ether functionalities. The presence of the ethoxy group can enhance solubility in organic solvents, while the methyl ester can participate in various chemical reactions, such as esterification and hydrolysis. Methyl 7-ethoxy-2-benzofurancarboxylate may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and reactivity would depend on the context of its use, including potential roles in synthesis or as a precursor in the development of more complex molecules. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C12H12O4
InChI:InChI=1S/C12H12O4/c1-3-15-9-6-4-5-8-7-10(12(13)14-2)16-11(8)9/h4-7H,3H2,1-2H3
InChI key:InChIKey=NFSLBOPJUNQAHM-UHFFFAOYSA-N
SMILES:O(CC)C1=C2C(C=C(C(OC)=O)O2)=CC=C1
Synonyms:
  • Methyl 7-ethoxy-2-benzofurancarboxylate
  • 2-Benzofurancarboxylic acid, 7-ethoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.