CymitQuimica logo

CAS 1407522-00-2

:

Methyl 3-fluoro-4-[[(2-hydroxyphenyl)methyl]amino]benzoate

Description:
Methyl 3-fluoro-4-[[(2-hydroxyphenyl)methyl]amino]benzoate, identified by its CAS number 1407522-00-2, is a chemical compound characterized by its complex structure, which includes a methyl ester functional group, a fluorine atom, and an amino group linked to a phenolic moiety. This compound is likely to exhibit properties typical of aromatic amines and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino and hydroxyl groups. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its biological activity. Methyl esters are often used in medicinal chemistry for drug development, and the presence of the hydroxyphenyl group may suggest potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's structure may allow for hydrogen bonding interactions, which could affect its stability and reactivity in various chemical environments. Overall, this compound's unique features make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C15H14FNO3
InChI:InChI=1S/C15H14FNO3/c1-20-15(19)10-6-7-13(12(16)8-10)17-9-11-4-2-3-5-14(11)18/h2-8,17-18H,9H2,1H3
InChI key:InChIKey=CITOAOCEIHVSEA-UHFFFAOYSA-N
SMILES:N(CC1=C(O)C=CC=C1)C2=C(F)C=C(C(OC)=O)C=C2
Synonyms:
  • Methyl 3-fluoro-4-[[(2-hydroxyphenyl)methyl]amino]benzoate
  • Benzoic acid, 3-fluoro-4-[[(2-hydroxyphenyl)methyl]amino]-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.