CAS 14077-79-3

5-(butan-2-yl)pyrimidine-2,4,6(1H,3H,5H)-trione

Description:

5-(Butan-2-yl)pyrimidine-2,4,6(1H,3H,5H)-trione, with the CAS number 14077-79-3, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a butan-2-yl group and three carbonyl groups at positions 2, 4, and 6. This compound exhibits properties typical of pyrimidine derivatives, including potential biological activity due to the presence of the pyrimidine core, which is known for its role in nucleic acids and various biochemical processes. The presence of multiple carbonyl groups contributes to its reactivity, making it a candidate for various chemical transformations. Additionally, the butan-2-yl substituent may influence its solubility and interaction with other molecules, potentially affecting its pharmacological properties. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Overall, its unique structure and functional groups suggest a range of possible applications in organic synthesis and drug development.

Formula: C₈H₁₂N₂O₃

InChI: InChI=1/C8H12N2O3/c1-3-4(2)5-6(11)9-8(13)10-7(5)12/h4-5H,3H2,1-2H3,(H2,9,10,11,12,13)

SMILES: CCC(C)C1C(=NC(=O)N=C1O)O

5-sec-Butylbarbituric Acid

CAS: 14077-79-3

Formula: C₈H₁₂N₂O₃

Ref: TR-TRC-B690910

5-sec-Butylbarbituric Acid

Controlled Product

CAS: 14077-79-3

Applications 5-sec-Butylbarbituric Acid is an intermediate in the synthesis of Talbutal (T004975), a short to intermediate-acting barbiturate that act as nonselective depressants of the central nervous system (CNS).
References Valwiler, E.H., et al.: J. Am. Chem. Soc., 47, 2236 (1925);

Formula: C₈H₁₂N₂O₃

Color and Shape: Neat

Molecular weight: 184.19

Ref: TR-B690910