CAS 14080-32-1
:5-nitropyrimidine
Description:
5-Nitropyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3, with a nitro group (-NO2) attached at the 5-position. This compound is typically a pale yellow solid and is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the nitro group enhances its electrophilic character, making it a useful intermediate in various chemical syntheses, particularly in the production of pharmaceuticals and agrochemicals. 5-Nitropyrimidine is soluble in polar organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the nitro group, which can participate in nucleophilic substitution reactions. Additionally, it may undergo reduction or further functionalization, making it a versatile building block in organic synthesis. Safety precautions should be observed when handling this compound, as nitro compounds can be hazardous and may pose environmental risks.
Formula:C4H3N3O2
InChI:InChI=1/C4H3N3O2/c8-7(9)4-1-5-3-6-2-4/h1-3H
SMILES:c1c(cncn1)N(=O)=O
Synonyms:- Pyrimidine, 5-nitro- (8CI,9CI)
- Pyrimidine, 5-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Nitropyrimidine
CAS:<p>5-Nitropyrimidine is a chemical with antiviral properties. It inhibits the synthesis of new viruses by reacting with malonic acid, which is an intermediate in the virus's life cycle. 5-Nitropyrimidine has also been shown to have anti-malarial and anti-parasitic properties. This compound binds to amines and inhibits their production, which may be due to its ability to react with dialkylamino groups in proteins. 5-Nitropyrimidine has been found in humans and animals, but not plants or fungi.</p>Formula:C4H3N3O2Purity:Min. 95%Molecular weight:125.09 g/mol
