CAS 14080-58-1
:4-HYDRAZINOTHIENO[2,3-D]PYRIMIDINE
Description:
4-Hydrazinothieno[2,3-d]pyrimidine is a heterocyclic compound characterized by the presence of a thieno-pyrimidine framework with a hydrazine functional group. This compound typically exhibits a fused bicyclic structure, which contributes to its unique chemical properties. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the hydrazine group can impart reactivity, allowing for various chemical transformations and interactions. Additionally, the thieno and pyrimidine rings can influence the compound's solubility, stability, and interaction with biological targets. As with many heterocycles, the electronic properties of 4-hydrazinothieno[2,3-d]pyrimidine can be modulated through substitution, which may enhance its pharmacological profile. Overall, this compound represents a significant interest in research fields focused on drug discovery and development, particularly for its potential therapeutic applications.
Formula:C6H6N4S
InChI:InChI=1/C6H6N4S/c7-10-5-4-1-2-11-6(4)9-3-8-5/h1-3H,7H2,(H,8,9,10)
SMILES:c1csc2c1c(ncn2)NN
Synonyms:- Buttpark 145\18-36
- 4-Hydrazinylthieno[2,3-D]Pyrimidine
- thieno[2,3-d]pyrimidin-4-ylhydrazine
- 4-hydrazineylthieno[2,3-d]pyrimidine
- 4-HYDRAZINOTHIENO[2,3-D]PYRIMIDINE
- Thieno[2,3-d]pyrimidine, 4-hydrazinyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Hydrazinylthieno[2,3-d]pyrimidine
CAS:Formula:C6H6N4SColor and Shape:SolidMolecular weight:166.20364-hydrazinothieno[2,3-d]pyrimidine
CAS:4-hydrazinothieno[2,3-d]pyrimidinePurity:≥95%Color and Shape:SolidMolecular weight:166.20363g/mol4-Hydrazinothieno[2,3-d]pyrimidine
CAS:4-Hydrazinothieno[2,3-d]pyrimidine is an anti-cancer drug that is activated by xylene. It is used in the treatment of bowel disease and cancer. 4-Hydrazinothieno[2,3-d]pyrimidine has been shown to have antibacterial properties against Gram-positive bacteria and may be effective as a topical agent for skin infections. This drug also has platelet activating properties, which are mediated through the p2y12 receptor. This receptor is involved in inflammatory bowel disease, as well as other tissues such as the brain and heart. 4-Hydrazinothieno[2,3-d]pyrimidine may be useful in treating cancer because it inhibits the production of TNF-α (tumour necrosis factor alpha) which leads to tumor growth inhibition.
Formula:C6H6N4SPurity:Min. 95%Molecular weight:166.2 g/mol



