CAS 1408058-16-1
:Methyl 1-(2,4-dichlorophenyl)-4-oxocyclohexanecarboxylate
Description:
Methyl 1-(2,4-dichlorophenyl)-4-oxocyclohexanecarboxylate, identified by its CAS number 1408058-16-1, is a chemical compound characterized by its complex structure, which includes a cyclohexane ring, a carboxylate ester functional group, and a dichlorophenyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the dichlorophenyl group suggests that it may have significant biological activity, possibly influencing its interactions in various chemical environments. Methyl esters like this one are often used in organic synthesis and may serve as intermediates in the production of pharmaceuticals or agrochemicals. The compound's stability, boiling point, melting point, and solubility in various solvents would depend on its specific molecular interactions and the presence of functional groups. Overall, Methyl 1-(2,4-dichlorophenyl)-4-oxocyclohexanecarboxylate represents a class of compounds with diverse applications in chemical research and industry.
Formula:C14H14Cl2O3
InChI:InChI=1S/C14H14Cl2O3/c1-19-13(18)14(6-4-10(17)5-7-14)11-3-2-9(15)8-12(11)16/h2-3,8H,4-7H2,1H3
InChI key:InChIKey=WFAVFMSVJVTQKH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(CCC(=O)CC1)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- Methyl 1-(2,4-dichlorophenyl)-4-oxocyclohexanecarboxylate
- Cyclohexanecarboxylic acid, 1-(2,4-dichlorophenyl)-4-oxo-, methyl ester
- Methyl 1-(2,4-dichlorophenyl)-4-oxocyclohexane-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Methyl 1-(2,4-dichlorophenyl)-4-oxocyclohexanecarboxylate
CAS:Formula:C14H14Cl2O3Molecular weight:301.1652Methyl 1-(2,4-Dichlorophenyl)-4-oxocyclohexanecarboxylate
CAS:Methyl 1-(2,4-Dichlorophenyl)-4-oxocyclohexanecarboxylate
Molecular weight:301.17g/mol

