
CAS 1408074-56-5: Cyclobutanamine, 3-(methylsulfonyl)-, hydrochloride (1:1), cis-
Description:Cyclobutanamine, 3-(methylsulfonyl)-, hydrochloride (1:1), cis- is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a methylsulfonyl functional group. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The "cis" designation refers to the specific stereochemistry of the compound, indicating that certain substituents are positioned on the same side of the cyclobutane ring. This stereochemical configuration can significantly influence the compound's biological activity and interactions. Cyclobutanamines are of interest in medicinal chemistry due to their potential therapeutic properties, and the methylsulfonyl group may contribute to the compound's reactivity and solubility. Overall, this compound's characteristics make it a subject of interest for further research, particularly in drug development and synthesis.
Formula:C5H11NO2S.ClH
InChI:InChI=1/C5H11NO2S.ClH/c1-9(7,8)5-2-4(6)3-5;/h4-5H,2-3,6H2,1H3;1H/t4-,5+;
InChI key:InChIKey=FGZJADAEEWGMEC-JEVYUYNZNA-N
SMILES:Cl.O=S(=O)(C)C1CC(N)C1

Cyclobutanamine, 3-(methylsulfonyl)-, hydrochloride (1:1), cis-
Ref: IN-DA001CT7
Undefined size | To inquire |

Ref: 54-OR317291
Undefined size | To inquire |

Cis-3-Methylsulfonylcyclobutylamine hydrochloride
Ref: 10-F467984
250mg | To inquire | ||
500mg | To inquire |

cis-3-methylsulfonylcyclobutylamine hcl
Ref: 3D-IGC07456
50mg | 682.00 € | ||
500mg | 1,916.00 € |

cis-3-(Methylsulfonyl)cyclobutanamine hydrochloride
Ref: 10-F983709
1g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |