CymitQuimica logo

CAS 1408074-62-3

:

4-Ethynyl-2,2-difluoro-1,3-benzodioxole

Description:
4-Ethynyl-2,2-difluoro-1,3-benzodioxole is an organic compound characterized by its unique structure, which includes a benzodioxole framework with ethynyl and difluoro substituents. This compound features a dioxole ring, which contributes to its aromatic properties and stability. The presence of the ethynyl group introduces a triple bond, enhancing its reactivity and potential for further chemical modifications. The difluoro substituents provide significant electronic effects, influencing the compound's polarity and reactivity. Typically, compounds like this may exhibit interesting properties such as fluorescence or unique solubility characteristics, depending on their molecular interactions. Additionally, the presence of fluorine atoms often enhances the compound's thermal and chemical stability, making it suitable for various applications in materials science and organic synthesis. However, specific applications and behaviors would depend on the context of use and the surrounding chemical environment. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H4F2O2
InChI:InChI=1S/C9H4F2O2/c1-2-6-4-3-5-7-8(6)13-9(10,11)12-7/h1,3-5H
InChI key:InChIKey=QLFBMXCCYXMPFZ-UHFFFAOYSA-N
SMILES:C(#C)C1=C2C(OC(F)(F)O2)=CC=C1
Synonyms:
  • 4-Ethynyl-2,2-difluoro-1,3-benzodioxole
  • 1,3-Benzodioxole, 4-ethynyl-2,2-difluoro-
Found 3 products.