CAS 1408074-78-1

1,1-Dimethylethyl N-[(hexahydro-1H-azepin-4-yl)methyl]carbamate

Description:

1,1-Dimethylethyl N-[(hexahydro-1H-azepin-4-yl)methyl]carbamate, identified by its CAS number 1408074-78-1, is a chemical compound characterized by its unique structural features. It contains a carbamate functional group, which is indicative of its potential applications in various chemical reactions and biological activities. The presence of the hexahydro-1H-azepin moiety suggests that it may exhibit properties related to cyclic amines, potentially influencing its reactivity and interaction with biological systems. The dimethyl substitution on the tert-butyl group enhances its steric bulk, which can affect solubility and permeability. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural complexity and potential for biological activity. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₁₂H₂₄N₂O₂

InChI: InChI=1S/C12H24N2O2/c1-12(2,3)16-11(15)14-9-10-5-4-7-13-8-6-10/h10,13H,4-9H2,1-3H3,(H,14,15)

InChI key: InChIKey=VZWFLFITYZGQKZ-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C1CCCNCC1

Synonyms:

• Carbamic acid, N-[(hexahydro-1H-azepin-4-yl)methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[(hexahydro-1H-azepin-4-yl)methyl]carbamate

4-(Boc-aminomethyl)azepane

CAS: 1408074-78-1

Formula: C₁₂H₂₄N₂O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 228.3312

Ref: IN-DA00HVX2

4-(BOC-AMINOMETHYL)AZEPANE

CAS: 1408074-78-1

Formula: C₁₂H₂₄N₂O₂

Purity: 97%

Molecular weight: 228.336

Ref: 10-F503740